C29H40F2O2 — CID 121323753
4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-ethyl-6-propan-2-ylphenol (PubChem CID 121323753) has the molecular formula C29H40F2O2 and a molecular weight of 458.63 g/mol. Its IUPAC name is 4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-ethyl-6-propan-2-ylphenol.
| Compound Name | 4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-ethyl-6-propan-2-ylphenol |
|---|---|
| PubChem CID | 121323753 |
| Molecular Formula | C29H40F2O2 |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-ethyl-6-propan-2-ylphenol |
| SMILES | CCCCCC1CCC(c2ccc(C(F)(F)Oc3cc(CC)c(O)c(C(C)C)c3)cc2)CC1 |
| InChI | InChI=1S/C29H40F2O2/c1-5-7-8-9-21-10-12-23(13-11-21)24-14-16-25(17-15-24)29(30,31)33-26-18-22(6-2)28(32)27(19-26)20(3)4/h14-21,23,32H,5-13H2,1-4H3 |
| InChIKey | BDFDMBJFYSAUMU-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|