C30H38F3NO2 — CID 134244884
N-[3-[4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-fluorophenyl]propyl]prop-2-enamide (PubChem CID 134244884) has the molecular formula C30H38F3NO2 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-[3-[4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-fluorophenyl]propyl]prop-2-enamide.
| Compound Name | N-[3-[4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-fluorophenyl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 134244884 |
| Molecular Formula | C30H38F3NO2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | N-[3-[4-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]-2-fluorophenyl]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCc1ccc(OC(F)(F)c2ccc(C3CCC(CCCCC)CC3)cc2)cc1F |
| InChI | InChI=1S/C30H38F3NO2/c1-3-5-6-8-22-10-12-23(13-11-22)24-14-17-26(18-15-24)30(32,33)36-27-19-16-25(28(31)21-27)9-7-20-34-29(35)4-2/h4,14-19,21-23H,2-3,5-13,20H2,1H3,(H,34,35) |
| InChIKey | ZDYHYWJCPKMMIS-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|