C23H31F4NO — CID 135214795
N-[2,2,3,3-tetrafluoro-3-[4-(4-pentylcyclohexyl)phenyl]propyl]prop-2-enamide (PubChem CID 135214795) has the molecular formula C23H31F4NO and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[2,2,3,3-tetrafluoro-3-[4-(4-pentylcyclohexyl)phenyl]propyl]prop-2-enamide.
| Compound Name | N-[2,2,3,3-tetrafluoro-3-[4-(4-pentylcyclohexyl)phenyl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 135214795 |
| Molecular Formula | C23H31F4NO |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | N-[2,2,3,3-tetrafluoro-3-[4-(4-pentylcyclohexyl)phenyl]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(F)(F)C(F)(F)c1ccc(C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C23H31F4NO/c1-3-5-6-7-17-8-10-18(11-9-17)19-12-14-20(15-13-19)23(26,27)22(24,25)16-28-21(29)4-2/h4,12-15,17-18H,2-3,5-11,16H2,1H3,(H,28,29) |
| InChIKey | CURXYPMAOOUHHJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|