C34H47NO — CID 134246290
N-[[4-[3-methyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]cyclohexyl]methyl]prop-2-enamide (PubChem CID 134246290) has the molecular formula C34H47NO and a molecular weight of 485.76 g/mol. Its IUPAC name is N-[[4-[3-methyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]cyclohexyl]methyl]prop-2-enamide.
| Compound Name | N-[[4-[3-methyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]cyclohexyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 134246290 |
| Molecular Formula | C34H47NO |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 485.37 |
| IUPAC Name | N-[[4-[3-methyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]cyclohexyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC1CCC(c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C34H47NO/c1-4-6-7-8-26-9-13-28(14-10-26)29-17-19-31(20-18-29)33-22-21-32(23-25(33)3)30-15-11-27(12-16-30)24-35-34(36)5-2/h5,17-23,26-28,30H,2,4,6-16,24H2,1,3H3,(H,35,36) |
| InChIKey | DEDYFMZAXOVHRB-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|