C28H37NO — CID 135214843
N-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]prop-2-enamide (PubChem CID 135214843) has the molecular formula C28H37NO and a molecular weight of 403.61 g/mol. Its IUPAC name is N-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135214843 |
| Molecular Formula | C28H37NO |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | N-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2ccc(C3CCC(CCCCC)CC3)cc2)c(CC)c1 |
| InChI | InChI=1S/C28H37NO/c1-4-7-8-9-21-10-12-23(13-11-21)24-14-16-25(17-15-24)27-19-18-26(20-22(27)5-2)29-28(30)6-3/h6,14-21,23H,3-5,7-13H2,1-2H3,(H,29,30) |
| InChIKey | CHOCBOXLKWDTHE-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|