About N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal
N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal (PubChem CID 142282274) has the molecular formula C21H33NO
and a molecular weight of 315.50 g/mol. Its IUPAC name is N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal.
Molecular Properties
| Compound Name | N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal |
| PubChem CID | 142282274 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal |
| SMILES | C=CC=O.CCCCCC1CCC(c2ccc(NC)cc2)CC1 |
| InChI | InChI=1S/C18H29N.C3H4O/c1-3-4-5-6-15-7-9-16(10-8-15)17-11-13-18(19-2)14-12-17;1-2-3-4/h11-16,19H,3-10H2,1-2H3;2-3H,1H2 |
| InChIKey | STIPFAUMCVXXKC-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal?
The IUPAC name of N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal (CID 142282274) is N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal.
What is the SMILES notation for N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal?
The canonical SMILES for N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal is C=CC=O.CCCCCC1CCC(c2ccc(NC)cc2)CC1.
What is the InChIKey of N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal?
The InChIKey is STIPFAUMCVXXKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N.C3H4O/c1-3-4-5-6-15-7-9-16(10-8-15)17-11-13-18(19-2)14-12-17;1-2-3-4/h11-16,19H,3-10H2,1-2H3;2-3H,1H2.
What are the key properties of N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal?
N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal has a molecular weight of 315.50 g/mol, XLogP of 5.95, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-(4-pentylcyclohexyl)aniline;prop-2-enal is sourced from PubChem (CID 142282274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).