C31H38FNO — CID 145234936
6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-N-methylnaphthalen-2-amine;prop-2-enal (PubChem CID 145234936) has the molecular formula C31H38FNO and a molecular weight of 459.65 g/mol. Its IUPAC name is 6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-N-methylnaphthalen-2-amine;prop-2-enal.
| Compound Name | 6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-N-methylnaphthalen-2-amine;prop-2-enal |
|---|---|
| PubChem CID | 145234936 |
| Molecular Formula | C31H38FNO |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 6-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]-N-methylnaphthalen-2-amine;prop-2-enal |
| SMILES | C=CC=O.CCCCCC1CCC(c2ccc(-c3ccc4cc(NC)ccc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H34FN.C3H4O/c1-3-4-5-6-20-7-9-21(10-8-20)24-14-16-27(28(29)19-24)25-12-11-23-18-26(30-2)15-13-22(23)17-25;1-2-3-4/h11-21,30H,3-10H2,1-2H3;2-3H,1H2 |
| InChIKey | MRNLDNQRGVBHOP-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|