C31H38O — CID 139457537
4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenol (PubChem CID 139457537) has the molecular formula C31H38O and a molecular weight of 426.64 g/mol. Its IUPAC name is 4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenol.
| Compound Name | 4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenol |
|---|---|
| PubChem CID | 139457537 |
| Molecular Formula | C31H38O |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 4-[2-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenol |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(-c4ccc(O)cc4)c(CC)c3)cc2)CC1 |
| InChI | InChI=1S/C31H38O/c1-3-5-6-7-23-8-10-25(11-9-23)26-12-14-27(15-13-26)29-18-21-31(24(4-2)22-29)28-16-19-30(32)20-17-28/h12-23,25,32H,3-11H2,1-2H3 |
| InChIKey | IBRPSRZCKAXIKA-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|