C36H49NOS — CID 135218755
3-[4-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine (PubChem CID 135218755) has the molecular formula C36H49NOS and a molecular weight of 543.86 g/mol. Its IUPAC name is 3-[4-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine.
| Compound Name | 3-[4-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 135218755 |
| Molecular Formula | C36H49NOS |
| Molecular Weight | 543.86 g/mol |
| Exact Mass | 543.35 |
| IUPAC Name | 3-[4-[3-ethyl-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(-c4ccc(CCCN(C)SOC)cc4)cc3CC)cc2)CC1 |
| InChI | InChI=1S/C36H49NOS/c1-5-7-8-10-28-12-16-31(17-13-28)32-20-22-34(23-21-32)36-25-24-35(27-30(36)6-2)33-18-14-29(15-19-33)11-9-26-37(3)39-38-4/h14-15,18-25,27-28,31H,5-13,16-17,26H2,1-4H3 |
| InChIKey | XGDSOYOPCUHJAZ-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.86 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|