C28H40FNOS — CID 135218621
3-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine (PubChem CID 135218621) has the molecular formula C28H40FNOS and a molecular weight of 457.70 g/mol. Its IUPAC name is 3-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine.
| Compound Name | 3-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 135218621 |
| Molecular Formula | C28H40FNOS |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 3-[4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(CCCN(C)SOC)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H40FNOS/c1-4-5-6-8-22-10-14-24(15-11-22)26-18-19-27(28(29)21-26)25-16-12-23(13-17-25)9-7-20-30(2)32-31-3/h12-13,16-19,21-22,24H,4-11,14-15,20H2,1-3H3 |
| InChIKey | IUBRILCZAHNJFW-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|