C38H47NOS — CID 135218654
3-[4-[2-ethyl-4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine (PubChem CID 135218654) has the molecular formula C38H47NOS and a molecular weight of 565.87 g/mol. Its IUPAC name is 3-[4-[2-ethyl-4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine.
| Compound Name | 3-[4-[2-ethyl-4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 135218654 |
| Molecular Formula | C38H47NOS |
| Molecular Weight | 565.87 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | 3-[4-[2-ethyl-4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-N-methoxysulfanyl-N-methylpropan-1-amine |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(CCCN(C)SOC)cc4)c(CC)c3)c(CC)c2)cc1 |
| InChI | InChI=1S/C38H47NOS/c1-6-9-10-12-29-14-18-33(19-15-29)35-22-24-38(31(7-2)27-35)36-23-25-37(32(8-3)28-36)34-20-16-30(17-21-34)13-11-26-39(4)41-40-5/h14-25,27-28H,6-13,26H2,1-5H3 |
| InChIKey | KVPFVDUCNAMJSE-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.87 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|