C36H46O2 — CID 90245042
1-[4-[4-ethoxy-3-(1-ethoxyethenyl)pent-4-enyl]phenyl]-2-ethyl-4-(4-pentylphenyl)benzene (PubChem CID 90245042) has the molecular formula C36H46O2 and a molecular weight of 510.76 g/mol. Its IUPAC name is 1-[4-[4-ethoxy-3-(1-ethoxyethenyl)pent-4-enyl]phenyl]-2-ethyl-4-(4-pentylphenyl)benzene.
| Compound Name | 1-[4-[4-ethoxy-3-(1-ethoxyethenyl)pent-4-enyl]phenyl]-2-ethyl-4-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 90245042 |
| Molecular Formula | C36H46O2 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 1-[4-[4-ethoxy-3-(1-ethoxyethenyl)pent-4-enyl]phenyl]-2-ethyl-4-(4-pentylphenyl)benzene |
| SMILES | C=C(OCC)C(CCc1ccc(-c2ccc(-c3ccc(CCCCC)cc3)cc2CC)cc1)C(=C)OCC |
| InChI | InChI=1S/C36H46O2/c1-7-11-12-13-29-14-19-32(20-15-29)34-23-25-36(31(8-2)26-34)33-21-16-30(17-22-33)18-24-35(27(5)37-9-3)28(6)38-10-4/h14-17,19-23,25-26,35H,5-13,18,24H2,1-4H3 |
| InChIKey | KTJIUZZHIPAACC-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|