C41H52O6 — CID 153304374
[4-[4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]-2-[(3-hydroxy-2-methylidenebutanoyl)oxymethyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate (PubChem CID 153304374) has the molecular formula C41H52O6 and a molecular weight of 640.86 g/mol. Its IUPAC name is [4-[4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]-2-[(3-hydroxy-2-methylidenebutanoyl)oxymethyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate.
| Compound Name | [4-[4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]-2-[(3-hydroxy-2-methylidenebutanoyl)oxymethyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 153304374 |
| Molecular Formula | C41H52O6 |
| Molecular Weight | 640.86 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | [4-[4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]-2-[(3-hydroxy-2-methylidenebutanoyl)oxymethyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCC(CCc1ccc(-c2ccc(-c3ccc(CCCCC)cc3)cc2CC)cc1)COC(=O)C(=C)C(C)(C)O)C(C)O |
| InChI | InChI=1S/C41H52O6/c1-8-10-11-12-31-15-19-35(20-16-31)37-23-24-38(34(9-2)25-37)36-21-17-32(18-22-36)13-14-33(26-46-39(43)28(3)30(5)42)27-47-40(44)29(4)41(6,7)45/h15-25,30,33,42,45H,3-4,8-14,26-27H2,1-2,5-7H3 |
| InChIKey | GLBOKEWPCWPQIW-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.86 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|