C46H53FO5 — CID 153304365
[4-[3-ethyl-4-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-2-(2-methylprop-2-enoyloxymethyl)butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate (PubChem CID 153304365) has the molecular formula C46H53FO5 and a molecular weight of 704.92 g/mol. Its IUPAC name is [4-[3-ethyl-4-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-2-(2-methylprop-2-enoyloxymethyl)butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate.
| Compound Name | [4-[3-ethyl-4-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-2-(2-methylprop-2-enoyloxymethyl)butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 153304365 |
| Molecular Formula | C46H53FO5 |
| Molecular Weight | 704.92 g/mol |
| Exact Mass | 704.39 |
| IUPAC Name | [4-[3-ethyl-4-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-2-(2-methylprop-2-enoyloxymethyl)butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
| SMILES | C=C(C)C(=O)OCC(CCc1ccc(-c2ccc(-c3ccc(-c4ccc(CCCCC)cc4)cc3F)cc2)c(CC)c1)COC(=O)C(=C)C(C)(C)O |
| InChI | InChI=1S/C46H53FO5/c1-8-10-11-12-33-15-18-37(19-16-33)40-24-26-42(43(47)28-40)39-22-20-38(21-23-39)41-25-17-34(27-36(41)9-2)13-14-35(29-51-44(48)31(3)4)30-52-45(49)32(5)46(6,7)50/h15-28,35,50H,3,5,8-14,29-30H2,1-2,4,6-7H3 |
| InChIKey | MWCSSMYPQVAJRV-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.92 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|