C37H46O6 — CID 153304272
[2-[(3-hydroxy-2-methylidenebutanoyl)oxymethyl]-4-[6-(4-pentylphenyl)naphthalen-2-yl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate (PubChem CID 153304272) has the molecular formula C37H46O6 and a molecular weight of 586.77 g/mol. Its IUPAC name is [2-[(3-hydroxy-2-methylidenebutanoyl)oxymethyl]-4-[6-(4-pentylphenyl)naphthalen-2-yl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate.
| Compound Name | [2-[(3-hydroxy-2-methylidenebutanoyl)oxymethyl]-4-[6-(4-pentylphenyl)naphthalen-2-yl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 153304272 |
| Molecular Formula | C37H46O6 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | [2-[(3-hydroxy-2-methylidenebutanoyl)oxymethyl]-4-[6-(4-pentylphenyl)naphthalen-2-yl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCC(CCc1ccc2cc(-c3ccc(CCCCC)cc3)ccc2c1)COC(=O)C(=C)C(C)(C)O)C(C)O |
| InChI | InChI=1S/C37H46O6/c1-7-8-9-10-28-13-16-31(17-14-28)33-20-19-32-21-29(15-18-34(32)22-33)11-12-30(23-42-35(39)25(2)27(4)38)24-43-36(40)26(3)37(5,6)41/h13-22,27,30,38,41H,2-3,7-12,23-24H2,1,4-6H3 |
| InChIKey | YIQWCFGINNKVAX-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|