C38H55F3O5 — CID 147471768
[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-[2-(trifluoromethyl)prop-2-enoyloxymethyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate (PubChem CID 147471768) has the molecular formula C38H55F3O5 and a molecular weight of 648.85 g/mol. Its IUPAC name is [4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-[2-(trifluoromethyl)prop-2-enoyloxymethyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate.
| Compound Name | [4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-[2-(trifluoromethyl)prop-2-enoyloxymethyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 147471768 |
| Molecular Formula | C38H55F3O5 |
| Molecular Weight | 648.85 g/mol |
| Exact Mass | 648.40 |
| IUPAC Name | [4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]-2-[2-(trifluoromethyl)prop-2-enoyloxymethyl]butyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCC(CCc1ccc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1)COC(=O)C(=C)C(F)(F)F)C(C)(C)O |
| InChI | InChI=1S/C38H55F3O5/c1-6-7-8-9-28-12-16-31(17-13-28)33-20-22-34(23-21-33)32-18-14-29(15-19-32)10-11-30(24-45-35(42)26(2)37(4,5)44)25-46-36(43)27(3)38(39,40)41/h14-15,18-19,28,30-31,33-34,44H,2-3,6-13,16-17,20-25H2,1,4-5H3 |
| InChIKey | FBXNATRKRITVLW-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.85 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|