C41H60O4 — CID 138711035
[4-[3-ethyl-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2-(hydroxymethyl)butyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 138711035) has the molecular formula C41H60O4 and a molecular weight of 616.93 g/mol. Its IUPAC name is [4-[3-ethyl-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2-(hydroxymethyl)butyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [4-[3-ethyl-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2-(hydroxymethyl)butyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138711035 |
| Molecular Formula | C41H60O4 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.45 |
| IUPAC Name | [4-[3-ethyl-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2-(hydroxymethyl)butyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCC(CO)CCc1ccc(-c2ccc(C3CCC(C4CCC(CCCCC)CC4)CC3)cc2)c(CC)c1 |
| InChI | InChI=1S/C41H60O4/c1-5-7-8-9-31-12-15-35(16-13-31)36-17-19-37(20-18-36)38-21-23-39(24-22-38)40-25-14-32(26-34(40)6-2)10-11-33(27-42)29-45-41(43)30(3)28-44-4/h14,21-26,31,33,35-37,42H,3,5-13,15-20,27-29H2,1-2,4H3 |
| InChIKey | ALWWNZUXJHBLIL-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|