C33H52O3 — CID 146659711
[2-(hydroxymethyl)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]butyl] 2-methylidenebutanoate (PubChem CID 146659711) has the molecular formula C33H52O3 and a molecular weight of 496.78 g/mol. Its IUPAC name is [2-(hydroxymethyl)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]butyl] 2-methylidenebutanoate.
| Compound Name | [2-(hydroxymethyl)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]butyl] 2-methylidenebutanoate |
|---|---|
| PubChem CID | 146659711 |
| Molecular Formula | C33H52O3 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.39 |
| IUPAC Name | [2-(hydroxymethyl)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]butyl] 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCC(CO)CCc1ccc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C33H52O3/c1-4-6-7-8-26-11-15-29(16-12-26)31-19-21-32(22-20-31)30-17-13-27(14-18-30)9-10-28(23-34)24-36-33(35)25(3)5-2/h13-14,17-18,26,28-29,31-32,34H,3-12,15-16,19-24H2,1-2H3 |
| InChIKey | KMFNRWOWOVGCSZ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|