C36H50O6 — CID 145411726
[2-(hydroxymethyl)-4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate;2-(hydroxymethyl)prop-2-enal (PubChem CID 145411726) has the molecular formula C36H50O6 and a molecular weight of 578.79 g/mol. Its IUPAC name is [2-(hydroxymethyl)-4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate;2-(hydroxymethyl)prop-2-enal.
| Compound Name | [2-(hydroxymethyl)-4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate;2-(hydroxymethyl)prop-2-enal |
|---|---|
| PubChem CID | 145411726 |
| Molecular Formula | C36H50O6 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | [2-(hydroxymethyl)-4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate;2-(hydroxymethyl)prop-2-enal |
| SMILES | C=C(C=O)CO.C=C(CO)C(=O)OCC(CO)CCC1CCC(c2ccc(-c3ccc(CCCCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H44O4.C4H6O2/c1-3-4-5-6-25-9-13-28(14-10-25)30-17-19-31(20-18-30)29-15-11-26(12-16-29)7-8-27(22-34)23-36-32(35)24(2)21-33;1-4(2-5)3-6/h9-10,13-14,17-20,26-27,29,33-34H,2-8,11-12,15-16,21-23H2,1H3;2,6H,1,3H2 |
| InChIKey | YYMDDAPAGDQLAH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|