C39H56O4 — CID 138529431
[3-methoxy-2-[4-[2-[4-[4-(4-pentylphenyl)cyclohexyl]phenyl]ethyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138529431) has the molecular formula C39H56O4 and a molecular weight of 588.87 g/mol. Its IUPAC name is [3-methoxy-2-[4-[2-[4-[4-(4-pentylphenyl)cyclohexyl]phenyl]ethyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-methoxy-2-[4-[2-[4-[4-(4-pentylphenyl)cyclohexyl]phenyl]ethyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138529431 |
| Molecular Formula | C39H56O4 |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.42 |
| IUPAC Name | [3-methoxy-2-[4-[2-[4-[4-(4-pentylphenyl)cyclohexyl]phenyl]ethyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC)C1CCC(CCc2ccc(C3CCC(c4ccc(CCCCC)cc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C39H56O4/c1-4-5-6-7-30-10-16-33(17-11-30)35-22-24-36(25-23-35)34-18-12-31(13-19-34)8-9-32-14-20-37(21-15-32)38(27-42-3)28-43-39(41)29(2)26-40/h10-13,16-19,32,35-38,40H,2,4-9,14-15,20-28H2,1,3H3 |
| InChIKey | DIGYRDCOPRPYHJ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|