C39H56O3 — CID 134244694
[4-hydroxy-2-[4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]butyl] 2-methylidenepentanoate (PubChem CID 134244694) has the molecular formula C39H56O3 and a molecular weight of 572.87 g/mol. Its IUPAC name is [4-hydroxy-2-[4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]butyl] 2-methylidenepentanoate.
| Compound Name | [4-hydroxy-2-[4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]butyl] 2-methylidenepentanoate |
|---|---|
| PubChem CID | 134244694 |
| Molecular Formula | C39H56O3 |
| Molecular Weight | 572.87 g/mol |
| Exact Mass | 572.42 |
| IUPAC Name | [4-hydroxy-2-[4-[4-[4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]butyl] 2-methylidenepentanoate |
| SMILES | C=C(CCC)C(=O)OCC(CCO)C1CCC(C2CCC(c3ccc(-c4ccc(CCCCC)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C39H56O3/c1-4-6-7-9-30-10-12-31(13-11-30)32-14-16-33(17-15-32)34-18-20-35(21-19-34)36-22-24-37(25-23-36)38(26-27-40)28-42-39(41)29(3)8-5-2/h10-17,34-38,40H,3-9,18-28H2,1-2H3 |
| InChIKey | BOGKBEOJJNGVCM-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.87 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|