C40H58O4 — CID 145411566
[2-[4-[4-[2-ethyl-4-(2-ethyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]-3-hydroxypropyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145411566) has the molecular formula C40H58O4 and a molecular weight of 602.90 g/mol. Its IUPAC name is [2-[4-[4-[2-ethyl-4-(2-ethyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]-3-hydroxypropyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[4-[4-[2-ethyl-4-(2-ethyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]-3-hydroxypropyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145411566 |
| Molecular Formula | C40H58O4 |
| Molecular Weight | 602.90 g/mol |
| Exact Mass | 602.43 |
| IUPAC Name | [2-[4-[4-[2-ethyl-4-(2-ethyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]-3-hydroxypropyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CO)C1CCC(C2CCC(c3ccc(-c4ccc(CCCCC)cc4CC)cc3CC)CC2)CC1 |
| InChI | InChI=1S/C40H58O4/c1-5-8-9-10-29-11-21-39(30(6-2)23-29)36-20-22-38(31(7-3)24-36)35-18-16-33(17-19-35)32-12-14-34(15-13-32)37(26-42)27-44-40(43)28(4)25-41/h11,20-24,32-35,37,41-42H,4-10,12-19,25-27H2,1-3H3 |
| InChIKey | MDLHEOXHZFVOED-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.90 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|