C42H60O6 — CID 166645906
[3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]-2-[4-[4-[3-methyl-4-(3-methyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 166645906) has the molecular formula C42H60O6 and a molecular weight of 660.94 g/mol. Its IUPAC name is [3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]-2-[4-[4-[3-methyl-4-(3-methyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]-2-[4-[4-[3-methyl-4-(3-methyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 166645906 |
| Molecular Formula | C42H60O6 |
| Molecular Weight | 660.94 g/mol |
| Exact Mass | 660.44 |
| IUPAC Name | [3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]-2-[4-[4-[3-methyl-4-(3-methyl-4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(O)C(=C)CO)C1CCC(C2CCC(c3ccc(-c4ccc(CCCCC)c(C)c4)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C42H60O6/c1-6-7-8-9-32-10-19-38(22-28(32)2)40-21-20-37(23-29(40)3)35-15-11-33(12-16-35)34-13-17-36(18-14-34)39(26-47-41(45)30(4)24-43)27-48-42(46)31(5)25-44/h10,19-23,33-36,39,41,43-45H,4-9,11-18,24-27H2,1-3H3 |
| InChIKey | JXQUXBSVIWKVRU-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.94 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|