C38H55FO4 — CID 145411830
[2-[4-[4-[4-(3-fluoro-4-pentylcyclohexa-1,5-dien-1-yl)-3-methylphenyl]cyclohexyl]cyclohexyl]-3-methoxypropyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145411830) has the molecular formula C38H55FO4 and a molecular weight of 594.85 g/mol. Its IUPAC name is [2-[4-[4-[4-(3-fluoro-4-pentylcyclohexa-1,5-dien-1-yl)-3-methylphenyl]cyclohexyl]cyclohexyl]-3-methoxypropyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[4-[4-[4-(3-fluoro-4-pentylcyclohexa-1,5-dien-1-yl)-3-methylphenyl]cyclohexyl]cyclohexyl]-3-methoxypropyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145411830 |
| Molecular Formula | C38H55FO4 |
| Molecular Weight | 594.85 g/mol |
| Exact Mass | 594.41 |
| IUPAC Name | [2-[4-[4-[4-(3-fluoro-4-pentylcyclohexa-1,5-dien-1-yl)-3-methylphenyl]cyclohexyl]cyclohexyl]-3-methoxypropyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC)C1CCC(C2CCC(c3ccc(C4=CC(F)C(CCCCC)C=C4)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C38H55FO4/c1-5-6-7-8-32-17-18-34(22-37(32)39)36-20-19-33(21-26(36)2)30-13-9-28(10-14-30)29-11-15-31(16-12-29)35(24-42-4)25-43-38(41)27(3)23-40/h17-22,28-32,35,37,40H,3,5-16,23-25H2,1-2,4H3 |
| InChIKey | JMOOHVNLLDZVJX-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.85 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|