C37H64O4 — CID 142282471
[3-methoxy-2-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 142282471) has the molecular formula C37H64O4 and a molecular weight of 572.92 g/mol. Its IUPAC name is [3-methoxy-2-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-methoxy-2-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 142282471 |
| Molecular Formula | C37H64O4 |
| Molecular Weight | 572.92 g/mol |
| Exact Mass | 572.48 |
| IUPAC Name | [3-methoxy-2-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC)C1CCC(C2CCC(C3CCC(C4CCC(CCCCC)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C37H64O4/c1-4-5-6-7-28-8-10-29(11-9-28)30-12-14-31(15-13-30)32-16-18-33(19-17-32)34-20-22-35(23-21-34)36(25-40-3)26-41-37(39)27(2)24-38/h28-36,38H,2,4-26H2,1,3H3 |
| InChIKey | PCQHTABCPCYMDT-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.92 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|