C30H50O6 — CID 138529604
[3-[2-(methoxymethyl)prop-2-enoyloxy]-2-[4-(4-pentylcyclohexyl)cyclohexyl]propyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 138529604) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is [3-[2-(methoxymethyl)prop-2-enoyloxy]-2-[4-(4-pentylcyclohexyl)cyclohexyl]propyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [3-[2-(methoxymethyl)prop-2-enoyloxy]-2-[4-(4-pentylcyclohexyl)cyclohexyl]propyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138529604 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | [3-[2-(methoxymethyl)prop-2-enoyloxy]-2-[4-(4-pentylcyclohexyl)cyclohexyl]propyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCC(COC(=O)C(=C)COC)C1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C30H50O6/c1-6-7-8-9-24-10-12-25(13-11-24)26-14-16-27(17-15-26)28(20-35-29(31)22(2)18-33-4)21-36-30(32)23(3)19-34-5/h24-28H,2-3,6-21H2,1,4-5H3 |
| InChIKey | JRMMAVYAQAQGRC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|