C32H54O5 — CID 138711008
[2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-methylidenebutanoate (PubChem CID 138711008) has the molecular formula C32H54O5 and a molecular weight of 518.78 g/mol. Its IUPAC name is [2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-methylidenebutanoate.
| Compound Name | [2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-methylidenebutanoate |
|---|---|
| PubChem CID | 138711008 |
| Molecular Formula | C32H54O5 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.40 |
| IUPAC Name | [2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCC(CCC1CCC(C2CCC(CCCCC)CC2)CC1)COC(=O)C(=C)COC |
| InChI | InChI=1S/C32H54O5/c1-6-8-9-10-26-13-17-29(18-14-26)30-19-15-27(16-20-30)11-12-28(22-36-31(33)24(3)7-2)23-37-32(34)25(4)21-35-5/h26-30H,3-4,6-23H2,1-2,5H3 |
| InChIKey | TUJNNKDESLGDMX-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|