C32H58O4 — CID 145411984
[2-(methoxymethyl)-4-[4-[5-(4-pentylcyclohexyl)pentyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145411984) has the molecular formula C32H58O4 and a molecular weight of 506.81 g/mol. Its IUPAC name is [2-(methoxymethyl)-4-[4-[5-(4-pentylcyclohexyl)pentyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-(methoxymethyl)-4-[4-[5-(4-pentylcyclohexyl)pentyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145411984 |
| Molecular Formula | C32H58O4 |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 506.43 |
| IUPAC Name | [2-(methoxymethyl)-4-[4-[5-(4-pentylcyclohexyl)pentyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCC1CCC(CCCCCC2CCC(CCCCC)CC2)CC1)COC |
| InChI | InChI=1S/C32H58O4/c1-4-5-7-10-27-13-15-28(16-14-27)11-8-6-9-12-29-17-19-30(20-18-29)21-22-31(24-35-3)25-36-32(34)26(2)23-33/h27-31,33H,2,4-25H2,1,3H3 |
| InChIKey | VIDFGLWRDYVHCR-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|