C28H46O5 — CID 138529668
[2-[4-(4-pentylcyclohexyl)cyclohexyl]-4-prop-2-enoyloxybutyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138529668) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is [2-[4-(4-pentylcyclohexyl)cyclohexyl]-4-prop-2-enoyloxybutyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[4-(4-pentylcyclohexyl)cyclohexyl]-4-prop-2-enoyloxybutyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138529668 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | [2-[4-(4-pentylcyclohexyl)cyclohexyl]-4-prop-2-enoyloxybutyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)OCCC(COC(=O)C(=C)CO)C1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C28H46O5/c1-4-6-7-8-22-9-11-23(12-10-22)24-13-15-25(16-14-24)26(17-18-32-27(30)5-2)20-33-28(31)21(3)19-29/h5,22-26,29H,2-4,6-20H2,1H3 |
| InChIKey | DMKQJJCMNYWYTI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|