C18H32O3 — CID 134244614
[3-hydroxy-2-(4-pentylcyclohexyl)propyl] 2-methylprop-2-enoate (PubChem CID 134244614) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is [3-hydroxy-2-(4-pentylcyclohexyl)propyl] 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-2-(4-pentylcyclohexyl)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134244614 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | [3-hydroxy-2-(4-pentylcyclohexyl)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)C1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C18H32O3/c1-4-5-6-7-15-8-10-16(11-9-15)17(12-19)13-21-18(20)14(2)3/h15-17,19H,2,4-13H2,1,3H3 |
| InChIKey | AOVPACFYKJAVON-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|