C24H39F3O3 — CID 138529550
[3-hydroxy-2-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]propyl] 2-methylprop-2-enoate (PubChem CID 138529550) has the molecular formula C24H39F3O3 and a molecular weight of 432.57 g/mol. Its IUPAC name is [3-hydroxy-2-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-2-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138529550 |
| Molecular Formula | C24H39F3O3 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | [3-hydroxy-2-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)C1CCC(C2CCC(CCCCC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C24H39F3O3/c1-17(2)23(29)30-16-22(15-28)21-12-10-20(11-13-21)19-8-6-18(7-9-19)5-3-4-14-24(25,26)27/h18-22,28H,1,3-16H2,2H3 |
| InChIKey | MPIDJSPBTURODW-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|