C28H43F3O5 — CID 139525091
[3-(2-methylprop-2-enoyloxy)-2-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 139525091) has the molecular formula C28H43F3O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxy)-2-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-(2-methylprop-2-enoyloxy)-2-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 139525091 |
| Molecular Formula | C28H43F3O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxy)-2-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)CO)C1CCC(C2CCC(CCCCC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C28H43F3O5/c1-19(2)26(33)35-17-25(18-36-27(34)20(3)16-32)24-13-11-23(12-14-24)22-9-7-21(8-10-22)6-4-5-15-28(29,30)31/h21-25,32H,1,3-18H2,2H3 |
| InChIKey | CILWZAVTKBWQEY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|