C24H40O6 — CID 138710894
[3-[2-(ethoxymethyl)prop-2-enoyloxy]-2-(4-pentylcyclohexyl)propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138710894) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is [3-[2-(ethoxymethyl)prop-2-enoyloxy]-2-(4-pentylcyclohexyl)propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[2-(ethoxymethyl)prop-2-enoyloxy]-2-(4-pentylcyclohexyl)propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138710894 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | [3-[2-(ethoxymethyl)prop-2-enoyloxy]-2-(4-pentylcyclohexyl)propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(=C)COCC)C1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C24H40O6/c1-5-7-8-9-20-10-12-21(13-11-20)22(16-29-23(26)18(3)14-25)17-30-24(27)19(4)15-28-6-2/h20-22,25H,3-17H2,1-2H3 |
| InChIKey | YSCCXQGTOMFYDU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|