C31H52O5 — CID 134245304
[2-(2-hydroxyethyl)-4-(2-methylprop-2-enoyloxy)-3-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-methylprop-2-enoate (PubChem CID 134245304) has the molecular formula C31H52O5 and a molecular weight of 504.75 g/mol. Its IUPAC name is [2-(2-hydroxyethyl)-4-(2-methylprop-2-enoyloxy)-3-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-methylprop-2-enoate.
| Compound Name | [2-(2-hydroxyethyl)-4-(2-methylprop-2-enoyloxy)-3-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134245304 |
| Molecular Formula | C31H52O5 |
| Molecular Weight | 504.75 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | [2-(2-hydroxyethyl)-4-(2-methylprop-2-enoyloxy)-3-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCO)C(COC(=O)C(=C)C)C1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C31H52O5/c1-6-7-8-9-24-10-12-25(13-11-24)26-14-16-27(17-15-26)29(21-36-31(34)23(4)5)28(18-19-32)20-35-30(33)22(2)3/h24-29,32H,2,4,6-21H2,1,3,5H3 |
| InChIKey | BJGDJPIVFFVLPK-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|