C29H52O4 — CID 134246213
[2-(2-hydroxyethoxymethyl)-3-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]propyl] 2-methylprop-2-enoate (PubChem CID 134246213) has the molecular formula C29H52O4 and a molecular weight of 464.73 g/mol. Its IUPAC name is [2-(2-hydroxyethoxymethyl)-3-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-(2-hydroxyethoxymethyl)-3-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134246213 |
| Molecular Formula | C29H52O4 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.39 |
| IUPAC Name | [2-(2-hydroxyethoxymethyl)-3-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COCCO)CC1CCC(CCC2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C29H52O4/c1-4-5-6-7-24-8-10-25(11-9-24)12-13-26-14-16-27(17-15-26)20-28(21-32-19-18-30)22-33-29(31)23(2)3/h24-28,30H,2,4-22H2,1,3H3 |
| InChIKey | ZOFBBUNJMPSKHA-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|