C31H52F2O6 — CID 166645799
[2-[[4-[difluoro-(4-pentylcyclohexyl)oxymethyl]cyclohexyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 166645799) has the molecular formula C31H52F2O6 and a molecular weight of 558.75 g/mol. Its IUPAC name is [2-[[4-[difluoro-(4-pentylcyclohexyl)oxymethyl]cyclohexyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | [2-[[4-[difluoro-(4-pentylcyclohexyl)oxymethyl]cyclohexyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166645799 |
| Molecular Formula | C31H52F2O6 |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.37 |
| IUPAC Name | [2-[[4-[difluoro-(4-pentylcyclohexyl)oxymethyl]cyclohexyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(C)(C)CO)CC1CCC(C(F)(F)OC2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C31H52F2O6/c1-6-7-8-9-23-12-16-27(17-13-23)39-31(32,33)26-14-10-24(11-15-26)18-25(19-37-28(35)22(2)3)20-38-29(36)30(4,5)21-34/h23-27,34H,2,6-21H2,1,3-5H3 |
| InChIKey | HTSGHGPKKZLNQS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|