C33H58O5 — CID 139524924
[2-(2-methylprop-2-enoyloxymethyl)-2-[4-(4-pentylcyclohexyl)cyclohexyl]hexyl] 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 139524924) has the molecular formula C33H58O5 and a molecular weight of 534.82 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoyloxymethyl)-2-[4-(4-pentylcyclohexyl)cyclohexyl]hexyl] 3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | [2-(2-methylprop-2-enoyloxymethyl)-2-[4-(4-pentylcyclohexyl)cyclohexyl]hexyl] 3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139524924 |
| Molecular Formula | C33H58O5 |
| Molecular Weight | 534.82 g/mol |
| Exact Mass | 534.43 |
| IUPAC Name | [2-(2-methylprop-2-enoyloxymethyl)-2-[4-(4-pentylcyclohexyl)cyclohexyl]hexyl] 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCC(CCCC)(COC(=O)C(C)(C)CO)C1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C33H58O5/c1-7-9-11-12-26-13-15-27(16-14-26)28-17-19-29(20-18-28)33(21-10-8-2,23-37-30(35)25(3)4)24-38-31(36)32(5,6)22-34/h26-29,34H,3,7-24H2,1-2,4-6H3 |
| InChIKey | SZBHSFCMAOHQBO-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.82 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|