C33H56O6 — CID 138529811
[2-[4-(4-heptylcyclohexyl)cyclohexyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]pentyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138529811) has the molecular formula C33H56O6 and a molecular weight of 548.81 g/mol. Its IUPAC name is [2-[4-(4-heptylcyclohexyl)cyclohexyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]pentyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[4-(4-heptylcyclohexyl)cyclohexyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]pentyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138529811 |
| Molecular Formula | C33H56O6 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | [2-[4-(4-heptylcyclohexyl)cyclohexyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]pentyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCC)(COC(=O)C(=C)CO)C1CCC(C2CCC(CCCCCCC)CC2)CC1 |
| InChI | InChI=1S/C33H56O6/c1-5-7-8-9-10-11-27-12-14-28(15-13-27)29-16-18-30(19-17-29)33(20-6-2,23-38-31(36)25(3)21-34)24-39-32(37)26(4)22-35/h27-30,34-35H,3-24H2,1-2H3 |
| InChIKey | MOHVYHLRIZWVOH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|