C32H56O5 — CID 138529447
[2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]-2-methyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2,2-dimethylpropanoate (PubChem CID 138529447) has the molecular formula C32H56O5 and a molecular weight of 520.80 g/mol. Its IUPAC name is [2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]-2-methyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]-2-methyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138529447 |
| Molecular Formula | C32H56O5 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.41 |
| IUPAC Name | [2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]-2-methyl-4-[4-(4-pentylcyclohexyl)cyclohexyl]butyl] 2,2-dimethylpropanoate |
| SMILES | C=C(CO)C(=O)OCC(C)(CCC1CCC(C2CCC(CCCCC)CC2)CC1)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H56O5/c1-7-8-9-10-25-11-15-27(16-12-25)28-17-13-26(14-18-28)19-20-32(6,22-36-29(34)24(2)21-33)23-37-30(35)31(3,4)5/h25-28,33H,2,7-23H2,1,3-6H3 |
| InChIKey | NVSBSXODPIAZRE-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|