C44H70O6 — CID 153434131
[(6Z)-4-[3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl]-5-methylidene-8-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]nona-6,8-dienyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 153434131) has the molecular formula C44H70O6 and a molecular weight of 695.04 g/mol. Its IUPAC name is [(6Z)-4-[3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl]-5-methylidene-8-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]nona-6,8-dienyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [(6Z)-4-[3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl]-5-methylidene-8-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]nona-6,8-dienyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 153434131 |
| Molecular Formula | C44H70O6 |
| Molecular Weight | 695.04 g/mol |
| Exact Mass | 694.52 |
| IUPAC Name | [(6Z)-4-[3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl]-5-methylidene-8-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]nona-6,8-dienyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCCC(CCCOC(=O)C(=C)CO)C(=C)/C=C\C(=C)C1CCC(C2CCC(C3CCC(CCCCC)CC3)CC2)CC1 |
| InChI | InChI=1S/C44H70O6/c1-6-7-8-11-36-16-18-39(19-17-36)41-24-26-42(27-25-41)40-22-20-38(21-23-40)33(3)15-14-32(2)37(12-9-28-49-43(47)34(4)30-45)13-10-29-50-44(48)35(5)31-46/h14-15,36-42,45-46H,2-13,16-31H2,1H3/b15-14- |
| InChIKey | NTQTWBBHBMFRIZ-PFONDFGASA-N |
| XLogP | 10.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.04 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|