C36H58O7 — CID 134246716
[3-(2-methylprop-2-enoyloxymethyl)-5-[[4-(4-pentylcyclohexyl)cyclohexyl]methyl]-6-prop-2-enoyloxyhexyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246716) has the molecular formula C36H58O7 and a molecular weight of 602.85 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxymethyl)-5-[[4-(4-pentylcyclohexyl)cyclohexyl]methyl]-6-prop-2-enoyloxyhexyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-(2-methylprop-2-enoyloxymethyl)-5-[[4-(4-pentylcyclohexyl)cyclohexyl]methyl]-6-prop-2-enoyloxyhexyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246716 |
| Molecular Formula | C36H58O7 |
| Molecular Weight | 602.85 g/mol |
| Exact Mass | 602.42 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxymethyl)-5-[[4-(4-pentylcyclohexyl)cyclohexyl]methyl]-6-prop-2-enoyloxyhexyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=CC(=O)OCC(CC1CCC(C2CCC(CCCCC)CC2)CC1)CC(CCOC(=O)C(=C)CO)COC(=O)C(=C)C |
| InChI | InChI=1S/C36H58O7/c1-6-8-9-10-28-11-15-32(16-12-28)33-17-13-29(14-18-33)21-31(25-42-34(38)7-2)22-30(24-43-35(39)26(3)4)19-20-41-36(40)27(5)23-37/h7,28-33,37H,2-3,5-6,8-25H2,1,4H3 |
| InChIKey | JKPDNXYPDALZLJ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.85 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|