C38H66O6 — CID 142282245
[2-(methoxymethyl)-3-[4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-eneperoxoate;2-methylprop-2-enal (PubChem CID 142282245) has the molecular formula C38H66O6 and a molecular weight of 618.94 g/mol. Its IUPAC name is [2-(methoxymethyl)-3-[4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-eneperoxoate;2-methylprop-2-enal.
| Compound Name | [2-(methoxymethyl)-3-[4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-eneperoxoate;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142282245 |
| Molecular Formula | C38H66O6 |
| Molecular Weight | 618.94 g/mol |
| Exact Mass | 618.49 |
| IUPAC Name | [2-(methoxymethyl)-3-[4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-eneperoxoate;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.C=C(CO)C(=O)OOCC(COC)CC1CCC(C2CCC(CCC3CCC(CCCCC)CC3)CC2)CC1 |
| InChI | InChI=1S/C34H60O5.C4H6O/c1-4-5-6-7-27-8-10-28(11-9-27)12-13-29-14-18-32(19-15-29)33-20-16-30(17-21-33)22-31(24-37-3)25-38-39-34(36)26(2)23-35;1-4(2)3-5/h27-33,35H,2,4-25H2,1,3H3;3H,1H2,2H3 |
| InChIKey | BZISMCLEDPIPRF-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.94 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|