C37H54O7 — CID 134246733
[3,5-bis(2-methylprop-2-enoyloxymethyl)-6-[4-(4-pentylcyclohexyl)phenyl]hexyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246733) has the molecular formula C37H54O7 and a molecular weight of 610.83 g/mol. Its IUPAC name is [3,5-bis(2-methylprop-2-enoyloxymethyl)-6-[4-(4-pentylcyclohexyl)phenyl]hexyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3,5-bis(2-methylprop-2-enoyloxymethyl)-6-[4-(4-pentylcyclohexyl)phenyl]hexyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246733 |
| Molecular Formula | C37H54O7 |
| Molecular Weight | 610.83 g/mol |
| Exact Mass | 610.39 |
| IUPAC Name | [3,5-bis(2-methylprop-2-enoyloxymethyl)-6-[4-(4-pentylcyclohexyl)phenyl]hexyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCOC(=O)C(=C)CO)CC(COC(=O)C(=C)C)Cc1ccc(C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C37H54O7/c1-7-8-9-10-29-11-15-33(16-12-29)34-17-13-30(14-18-34)21-32(25-44-36(40)27(4)5)22-31(24-43-35(39)26(2)3)19-20-42-37(41)28(6)23-38/h13-14,17-18,29,31-33,38H,2,4,6-12,15-16,19-25H2,1,3,5H3 |
| InChIKey | MFGXVGUYSHVNCK-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.83 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|