C39H56O6 — CID 145411779
2-(hydroxymethyl)prop-2-enal;[2-(methoxymethyl)-4-[4-[4-[2-(4-pentylphenyl)ethyl]phenyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145411779) has the molecular formula C39H56O6 and a molecular weight of 620.87 g/mol. Its IUPAC name is 2-(hydroxymethyl)prop-2-enal;[2-(methoxymethyl)-4-[4-[4-[2-(4-pentylphenyl)ethyl]phenyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-(hydroxymethyl)prop-2-enal;[2-(methoxymethyl)-4-[4-[4-[2-(4-pentylphenyl)ethyl]phenyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145411779 |
| Molecular Formula | C39H56O6 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.41 |
| IUPAC Name | 2-(hydroxymethyl)prop-2-enal;[2-(methoxymethyl)-4-[4-[4-[2-(4-pentylphenyl)ethyl]phenyl]cyclohexyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C=O)CO.C=C(CO)C(=O)OCC(CCC1CCC(c2ccc(CCc3ccc(CCCCC)cc3)cc2)CC1)COC |
| InChI | InChI=1S/C35H50O4.C4H6O2/c1-4-5-6-7-28-8-10-29(11-9-28)12-13-30-16-20-33(21-17-30)34-22-18-31(19-23-34)14-15-32(25-38-3)26-39-35(37)27(2)24-36;1-4(2-5)3-6/h8-11,16-17,20-21,31-32,34,36H,2,4-7,12-15,18-19,22-26H2,1,3H3;2,6H,1,3H2 |
| InChIKey | IEIRLOJRLFHNCY-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|