C40H62O6 — CID 138711135
[2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-4-[4-[4-(4-octylcyclohexyl)cyclohexyl]phenyl]butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138711135) has the molecular formula C40H62O6 and a molecular weight of 638.93 g/mol. Its IUPAC name is [2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-4-[4-[4-(4-octylcyclohexyl)cyclohexyl]phenyl]butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-4-[4-[4-(4-octylcyclohexyl)cyclohexyl]phenyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138711135 |
| Molecular Formula | C40H62O6 |
| Molecular Weight | 638.93 g/mol |
| Exact Mass | 638.45 |
| IUPAC Name | [2-[2-(methoxymethyl)prop-2-enoyloxymethyl]-4-[4-[4-(4-octylcyclohexyl)cyclohexyl]phenyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCc1ccc(C2CCC(C3CCC(CCCCCCCC)CC3)CC2)cc1)COC(=O)C(=C)COC |
| InChI | InChI=1S/C40H62O6/c1-5-6-7-8-9-10-11-32-14-18-35(19-15-32)37-22-24-38(25-23-37)36-20-16-33(17-21-36)12-13-34(28-45-39(42)30(2)26-41)29-46-40(43)31(3)27-44-4/h16-17,20-21,32,34-35,37-38,41H,2-3,5-15,18-19,22-29H2,1,4H3 |
| InChIKey | MHBNPJCDQVEVMP-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.93 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|