C39H60O6 — CID 149296614
[2-(2-methylprop-2-enoyloxymethyl)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]butyl] 2-(2-hydroxypropoxymethyl)prop-2-enoate (PubChem CID 149296614) has the molecular formula C39H60O6 and a molecular weight of 624.90 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoyloxymethyl)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]butyl] 2-(2-hydroxypropoxymethyl)prop-2-enoate.
| Compound Name | [2-(2-methylprop-2-enoyloxymethyl)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]butyl] 2-(2-hydroxypropoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 149296614 |
| Molecular Formula | C39H60O6 |
| Molecular Weight | 624.90 g/mol |
| Exact Mass | 624.44 |
| IUPAC Name | [2-(2-methylprop-2-enoyloxymethyl)-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]butyl] 2-(2-hydroxypropoxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCc1ccc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1)COC(=O)C(=C)COCC(C)O |
| InChI | InChI=1S/C39H60O6/c1-6-7-8-9-31-12-16-34(17-13-31)36-20-22-37(23-21-36)35-18-14-32(15-19-35)10-11-33(26-44-38(41)28(2)3)27-45-39(42)29(4)24-43-25-30(5)40/h14-15,18-19,30-31,33-34,36-37,40H,2,4,6-13,16-17,20-27H2,1,3,5H3 |
| InChIKey | XVXHNYOMYHDQOQ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.90 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|