C43H68O3 — CID 139525265
[2-(hydroxymethyl)-3-[6-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]propyl] 2-methylprop-2-enoate (PubChem CID 139525265) has the molecular formula C43H68O3 and a molecular weight of 633.01 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-[6-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-(hydroxymethyl)-3-[6-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139525265 |
| Molecular Formula | C43H68O3 |
| Molecular Weight | 633.01 g/mol |
| Exact Mass | 632.52 |
| IUPAC Name | [2-(hydroxymethyl)-3-[6-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)CC1CCC2CC(CCc3ccc(C4CCC(C5CCC(CCCCC)CC5)CC4)cc3)CCC2C1 |
| InChI | InChI=1S/C43H68O3/c1-4-5-6-7-32-10-16-37(17-11-32)39-22-24-40(25-23-39)38-18-12-33(13-19-38)8-9-34-14-20-42-28-35(15-21-41(42)27-34)26-36(29-44)30-46-43(45)31(2)3/h12-13,18-19,32,34-37,39-42,44H,2,4-11,14-17,20-30H2,1,3H3 |
| InChIKey | SUZGSZOGTMZJKF-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.01 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|