C34H52O6 — CID 138529750
[2-methyl-2-(2-methylprop-2-enoyloxymethyl)-4-[4-(4-pentylcyclohexyl)phenyl]butyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate (PubChem CID 138529750) has the molecular formula C34H52O6 and a molecular weight of 556.78 g/mol. Its IUPAC name is [2-methyl-2-(2-methylprop-2-enoyloxymethyl)-4-[4-(4-pentylcyclohexyl)phenyl]butyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate.
| Compound Name | [2-methyl-2-(2-methylprop-2-enoyloxymethyl)-4-[4-(4-pentylcyclohexyl)phenyl]butyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
|---|---|
| PubChem CID | 138529750 |
| Molecular Formula | C34H52O6 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | [2-methyl-2-(2-methylprop-2-enoyloxymethyl)-4-[4-(4-pentylcyclohexyl)phenyl]butyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
| SMILES | C=C(C)C(=O)OCC(C)(CCc1ccc(C2CCC(CCCCC)CC2)cc1)COC(=O)C(=C)CC(CO)CO |
| InChI | InChI=1S/C34H52O6/c1-6-7-8-9-27-10-14-30(15-11-27)31-16-12-28(13-17-31)18-19-34(5,23-39-32(37)25(2)3)24-40-33(38)26(4)20-29(21-35)22-36/h12-13,16-17,27,29-30,35-36H,2,4,6-11,14-15,18-24H2,1,3,5H3 |
| InChIKey | DXCRBGOMZFDPPE-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|