C37H60O6 — CID 145411691
[4-[4-(3-ethyl-4-pentylphenyl)cyclohexyl]-2-(methoxymethyl)-2-methylbutyl] 2-methylprop-2-enoate;5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanal (PubChem CID 145411691) has the molecular formula C37H60O6 and a molecular weight of 600.88 g/mol. Its IUPAC name is [4-[4-(3-ethyl-4-pentylphenyl)cyclohexyl]-2-(methoxymethyl)-2-methylbutyl] 2-methylprop-2-enoate;5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanal.
| Compound Name | [4-[4-(3-ethyl-4-pentylphenyl)cyclohexyl]-2-(methoxymethyl)-2-methylbutyl] 2-methylprop-2-enoate;5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanal |
|---|---|
| PubChem CID | 145411691 |
| Molecular Formula | C37H60O6 |
| Molecular Weight | 600.88 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | [4-[4-(3-ethyl-4-pentylphenyl)cyclohexyl]-2-(methoxymethyl)-2-methylbutyl] 2-methylprop-2-enoate;5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanal |
| SMILES | C=C(C)C(=O)OCC(C)(CCC1CCC(c2ccc(CCCCC)c(CC)c2)CC1)COC.C=C(C=O)CC(CO)CO |
| InChI | InChI=1S/C30H48O3.C7H12O3/c1-7-9-10-11-26-16-17-28(20-25(26)8-2)27-14-12-24(13-15-27)18-19-30(5,21-32-6)22-33-29(31)23(3)4;1-6(3-8)2-7(4-9)5-10/h16-17,20,24,27H,3,7-15,18-19,21-22H2,1-2,4-6H3;3,7,9-10H,1-2,4-5H2 |
| InChIKey | QYZUGZBPPPYTIT-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.88 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|