C35H54O6 — CID 138529746
[2-[4-(4-heptylcyclohexyl)phenyl]-2-(2-methylprop-2-enoyloxymethyl)butyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate (PubChem CID 138529746) has the molecular formula C35H54O6 and a molecular weight of 570.81 g/mol. Its IUPAC name is [2-[4-(4-heptylcyclohexyl)phenyl]-2-(2-methylprop-2-enoyloxymethyl)butyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate.
| Compound Name | [2-[4-(4-heptylcyclohexyl)phenyl]-2-(2-methylprop-2-enoyloxymethyl)butyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
|---|---|
| PubChem CID | 138529746 |
| Molecular Formula | C35H54O6 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | [2-[4-(4-heptylcyclohexyl)phenyl]-2-(2-methylprop-2-enoyloxymethyl)butyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
| SMILES | C=C(C)C(=O)OCC(CC)(COC(=O)C(=C)CC(CO)CO)c1ccc(C2CCC(CCCCCCC)CC2)cc1 |
| InChI | InChI=1S/C35H54O6/c1-6-8-9-10-11-12-28-13-15-30(16-14-28)31-17-19-32(20-18-31)35(7-2,24-40-33(38)26(3)4)25-41-34(39)27(5)21-29(22-36)23-37/h17-20,28-30,36-37H,3,5-16,21-25H2,1-2,4H3 |
| InChIKey | ACLZUOKDSFLEQF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|